About 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one
1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one (PubChem CID 59266666) has the molecular formula C10H14ClNOS
and a molecular weight of 231.75 g/mol. Its IUPAC name is 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 59266666 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCc1sc(Cl)nc1C(=O)C(C)(C)C |
| InChI | InChI=1S/C10H14ClNOS/c1-5-6-7(12-9(11)14-6)8(13)10(2,3)4/h5H2,1-4H3 |
| InChIKey | ICTRFEQOEVNIMO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one (CID 59266666) is 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one is CCc1sc(Cl)nc1C(=O)C(C)(C)C.
What is the InChIKey of 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one?
The InChIKey is ICTRFEQOEVNIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNOS/c1-5-6-7(12-9(11)14-6)8(13)10(2,3)4/h5H2,1-4H3.
What are the key properties of 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one?
1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one has a molecular weight of 231.75 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-5-ethyl-1,3-thiazol-4-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 59266666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).