About methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate
methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate (PubChem CID 59266740) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate.
Molecular Properties
| Compound Name | methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate |
| PubChem CID | 59266740 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H21NO3/c1-10(2)6-5-7-11(3)8-9-14-12(15)13(16)17-4/h6,8H,5,7,9H2,1-4H3,(H,14,15)/b11-8+ |
| InChIKey | YNYZYKPWDGZJAM-DHZHZOJOSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate?
The IUPAC name of methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate (CID 59266740) is methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate.
What is the SMILES notation for methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate?
The canonical SMILES for methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate is COC(=O)C(=O)NC/C=C(\C)CCC=C(C)C.
What is the InChIKey of methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate?
The InChIKey is YNYZYKPWDGZJAM-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H21NO3/c1-10(2)6-5-7-11(3)8-9-14-12(15)13(16)17-4/h6,8H,5,7,9H2,1-4H3,(H,14,15)/b11-8+.
What are the key properties of methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate?
methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate has a molecular weight of 239.31 g/mol, XLogP of 1.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate is sourced from PubChem (CID 59266740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).