C28H18F8O4S — CID 59266873
1-[4-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzene (PubChem CID 59266873) has the molecular formula C28H18F8O4S and a molecular weight of 602.50 g/mol. Its IUPAC name is 1-[4-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzene.
| Compound Name | 1-[4-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 59266873 |
| Molecular Formula | C28H18F8O4S |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | 1-[4-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluoro-4-methoxybenzene |
| SMILES | COc1c(F)c(F)c(-c2c(F)c(F)c(Oc3ccc(S(=O)(=O)c4ccc(C)c(C)c4)cc3C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C28H18F8O4S/c1-11-5-6-14(9-12(11)2)41(37,38)15-7-8-16(13(3)10-15)40-28-25(35)21(31)18(22(32)26(28)36)17-19(29)23(33)27(39-4)24(34)20(17)30/h5-10H,1-4H3 |
| InChIKey | OAPUAIHAHKRWAH-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.50 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|