C42H30N2O8S — CID 59266906
6-[3-[4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylphenoxy]phenyl]-13-(3-methylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 59266906) has the molecular formula C42H30N2O8S and a molecular weight of 722.77 g/mol. Its IUPAC name is 6-[3-[4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylphenoxy]phenyl]-13-(3-methylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-[3-[4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylphenoxy]phenyl]-13-(3-methylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 59266906 |
| Molecular Formula | C42H30N2O8S |
| Molecular Weight | 722.77 g/mol |
| Exact Mass | 722.17 |
| IUPAC Name | 6-[3-[4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylphenoxy]phenyl]-13-(3-methylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(Oc3cccc(N4C(=O)c5ccc6c7c(ccc(c57)C4=O)C(=O)N(c4cccc(C)c4)C6=O)c3)c(C)c2)cc1C |
| InChI | InChI=1S/C42H30N2O8S/c1-23-7-5-8-26(19-23)43-39(45)31-13-15-33-38-34(16-14-32(37(31)38)40(43)46)42(48)44(41(33)47)27-9-6-10-28(22-27)52-36-18-12-30(21-25(36)3)53(49,50)29-11-17-35(51-4)24(2)20-29/h5-22H,1-4H3 |
| InChIKey | LLPQSXGEYIINCS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.77 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|