C5H3F7O5S — CID 59266970
1,1-difluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethanesulfonic acid (PubChem CID 59266970) has the molecular formula C5H3F7O5S and a molecular weight of 308.13 g/mol. Its IUPAC name is 1,1-difluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 59266970 |
| Molecular Formula | C5H3F7O5S |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 1,1-difluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F7O5S/c6-3(7,18(14,15)16)1-17-2(13)4(8,9)5(10,11)12/h1H2,(H,14,15,16) |
| InChIKey | DTLDQAVTAARHJY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|