About benzene-1,2,4-tricarbonitrile
benzene-1,2,4-tricarbonitrile (PubChem CID 592670) has the molecular formula C9H3N3
and a molecular weight of 153.14 g/mol. Its IUPAC name is benzene-1,2,4-tricarbonitrile.
Molecular Properties
| Compound Name | benzene-1,2,4-tricarbonitrile |
| PubChem CID | 592670 |
| Molecular Formula | C9H3N3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | benzene-1,2,4-tricarbonitrile |
| SMILES | N#Cc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C9H3N3/c10-4-7-1-2-8(5-11)9(3-7)6-12/h1-3H |
| InChIKey | RTJRHFSBKHHQEI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene-1,2,4-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2,4-tricarbonitrile?
The IUPAC name of benzene-1,2,4-tricarbonitrile (CID 592670) is benzene-1,2,4-tricarbonitrile.
What is the SMILES notation for benzene-1,2,4-tricarbonitrile?
The canonical SMILES for benzene-1,2,4-tricarbonitrile is N#Cc1ccc(C#N)c(C#N)c1.
What is the InChIKey of benzene-1,2,4-tricarbonitrile?
The InChIKey is RTJRHFSBKHHQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3N3/c10-4-7-1-2-8(5-11)9(3-7)6-12/h1-3H.
What are the key properties of benzene-1,2,4-tricarbonitrile?
benzene-1,2,4-tricarbonitrile has a molecular weight of 153.14 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2,4-tricarbonitrile is sourced from PubChem (CID 592670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).