C26H24F5O3S+ — CID 59267074
[3,5-dimethyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium (PubChem CID 59267074) has the molecular formula C26H24F5O3S+ and a molecular weight of 511.53 g/mol. Its IUPAC name is [3,5-dimethyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59267074 |
| Molecular Formula | C26H24F5O3S+ |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | [3,5-dimethyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H24F5O3S/c1-18-15-22(35(20-9-5-3-6-10-20)21-11-7-4-8-12-21)16-19(2)24(18)34-17-23(32)33-14-13-25(27,28)26(29,30)31/h3-12,15-16H,13-14,17H2,1-2H3/q+1 |
| InChIKey | KOHOJOXLFDYLEG-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|