C27H24F7O3S+ — CID 59267080
[4-[2-(3,3,4,4,5,5,5-heptafluoropentoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 59267080) has the molecular formula C27H24F7O3S+ and a molecular weight of 561.54 g/mol. Its IUPAC name is [4-[2-(3,3,4,4,5,5,5-heptafluoropentoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(3,3,4,4,5,5,5-heptafluoropentoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59267080 |
| Molecular Formula | C27H24F7O3S+ |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | [4-[2-(3,3,4,4,5,5,5-heptafluoropentoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H24F7O3S/c1-18-15-22(38(20-9-5-3-6-10-20)21-11-7-4-8-12-21)16-19(2)24(18)37-17-23(35)36-14-13-25(28,29)26(30,31)27(32,33)34/h3-12,15-16H,13-14,17H2,1-2H3/q+1 |
| InChIKey | JDMDRGVUBDIKNI-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|