C25H22F5O3S+ — CID 59267081
[2-methyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium (PubChem CID 59267081) has the molecular formula C25H22F5O3S+ and a molecular weight of 497.51 g/mol. Its IUPAC name is [2-methyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [2-methyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59267081 |
| Molecular Formula | C25H22F5O3S+ |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [2-methyl-4-[2-oxo-2-(3,3,4,4,4-pentafluorobutoxy)ethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc(OCC(=O)OCCC(F)(F)C(F)(F)F)ccc1[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22F5O3S/c1-18-16-19(33-17-23(31)32-15-14-24(26,27)25(28,29)30)12-13-22(18)34(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,16H,14-15,17H2,1H3/q+1 |
| InChIKey | ADQZPAGQQRYINK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|