C26H22F7O3S+ — CID 59267093
[4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 59267093) has the molecular formula C26H22F7O3S+ and a molecular weight of 547.51 g/mol. Its IUPAC name is [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59267093 |
| Molecular Formula | C26H22F7O3S+ |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H22F7O3S/c1-17-13-21(37(19-9-5-3-6-10-19)20-11-7-4-8-12-20)14-18(2)23(17)35-15-22(34)36-16-24(27,28)25(29,30)26(31,32)33/h3-14H,15-16H2,1-2H3/q+1 |
| InChIKey | GRCMYVRGWAHLHD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|