C25H20F7O3S+ — CID 59267098
[4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-2-methylphenyl]-diphenylsulfanium (PubChem CID 59267098) has the molecular formula C25H20F7O3S+ and a molecular weight of 533.49 g/mol. Its IUPAC name is [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-2-methylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-2-methylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59267098 |
| Molecular Formula | C25H20F7O3S+ |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-2-methylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc(OCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)ccc1[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20F7O3S/c1-17-14-18(34-15-22(33)35-16-23(26,27)24(28,29)25(30,31)32)12-13-21(17)36(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-14H,15-16H2,1H3/q+1 |
| InChIKey | LEBPVTQCWWMBCW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|