C30H34ClO6P — CID 59267358
[4-[[4-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenyl] acetate (PubChem CID 59267358) has the molecular formula C30H34ClO6P and a molecular weight of 557.02 g/mol. Its IUPAC name is [4-[[4-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenyl] acetate.
| Compound Name | [4-[[4-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenyl] acetate |
|---|---|
| PubChem CID | 59267358 |
| Molecular Formula | C30H34ClO6P |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | [4-[[4-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cc2c(C)cc(OCP3(=O)OCC[C@@H](c4cccc(Cl)c4)O3)cc2C)cc1C(C)C |
| InChI | InChI=1S/C30H34ClO6P/c1-19(2)27-15-23(9-10-30(27)36-22(5)32)16-28-20(3)13-26(14-21(28)4)34-18-38(33)35-12-11-29(37-38)24-7-6-8-25(31)17-24/h6-10,13-15,17,19,29H,11-12,16,18H2,1-5H3/t29-,38?/m0/s1 |
| InChIKey | QFXHEEMAWAHMFS-SYOBGBQASA-N |
| XLogP | 8.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|