About 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid
5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid (PubChem CID 59267486) has the molecular formula C25H20ClN3O3
and a molecular weight of 445.91 g/mol. Its IUPAC name is 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid |
| PubChem CID | 59267486 |
| Molecular Formula | C25H20ClN3O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid |
| SMILES | Cc1cc(Oc2nc3cc(-c4ccc5c(ccn5C)c4)c(Cl)cc3[nH]2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C25H20ClN3O3/c1-13-8-17(10-18(14(13)2)24(30)31)32-25-27-21-11-19(20(26)12-22(21)28-25)15-4-5-23-16(9-15)6-7-29(23)3/h4-12H,1-3H3,(H,27,28)(H,30,31) |
| InChIKey | RSKMMGXOUQPZQX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid?
The IUPAC name of 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid (CID 59267486) is 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid.
What is the SMILES notation for 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid?
The canonical SMILES for 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid is Cc1cc(Oc2nc3cc(-c4ccc5c(ccn5C)c4)c(Cl)cc3[nH]2)cc(C(=O)O)c1C.
What is the InChIKey of 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid?
The InChIKey is RSKMMGXOUQPZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20ClN3O3/c1-13-8-17(10-18(14(13)2)24(30)31)32-25-27-21-11-19(20(26)12-22(21)28-25)15-4-5-23-16(9-15)6-7-29(23)3/h4-12H,1-3H3,(H,27,28)(H,30,31).
What are the key properties of 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid?
5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid has a molecular weight of 445.91 g/mol, XLogP of 6.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2,3-dimethylbenzoic acid is sourced from PubChem (CID 59267486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).