About 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid
5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (PubChem CID 59267798) has the molecular formula C23H13ClF2N2O3
and a molecular weight of 438.82 g/mol. Its IUPAC name is 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| PubChem CID | 59267798 |
| Molecular Formula | C23H13ClF2N2O3 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| SMILES | Cc1ccc(Oc2nc3cc(Cl)c(C#Cc4ccc(F)cc4F)cc3[nH]2)cc1C(=O)O |
| InChI | InChI=1S/C23H13ClF2N2O3/c1-12-2-7-16(10-17(12)22(29)30)31-23-27-20-8-14(18(24)11-21(20)28-23)4-3-13-5-6-15(25)9-19(13)26/h2,5-11H,1H3,(H,27,28)(H,29,30) |
| InChIKey | FTDIHRPSNIWVRM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
The IUPAC name of 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (CID 59267798) is 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid.
What is the SMILES notation for 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
The canonical SMILES for 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid is Cc1ccc(Oc2nc3cc(Cl)c(C#Cc4ccc(F)cc4F)cc3[nH]2)cc1C(=O)O.
What is the InChIKey of 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
The InChIKey is FTDIHRPSNIWVRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13ClF2N2O3/c1-12-2-7-16(10-17(12)22(29)30)31-23-27-20-8-14(18(24)11-21(20)28-23)4-3-13-5-6-15(25)9-19(13)26/h2,5-11H,1H3,(H,27,28)(H,29,30).
What are the key properties of 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid has a molecular weight of 438.82 g/mol, XLogP of 5.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[5-chloro-6-[2-(2,4-difluorophenyl)ethynyl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid is sourced from PubChem (CID 59267798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).