C5H11N5 — CID 59268401
1,2-bis[(Z)-ethylideneamino]guanidine (PubChem CID 59268401) has the molecular formula C5H11N5 and a molecular weight of 141.18 g/mol. Its IUPAC name is 1,2-bis[(Z)-ethylideneamino]guanidine.
| Compound Name | 1,2-bis[(Z)-ethylideneamino]guanidine |
|---|---|
| PubChem CID | 59268401 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 1,2-bis[(Z)-ethylideneamino]guanidine |
| SMILES | C/C=N\N=C(/N)N/N=C\C |
| InChI | InChI=1S/C5H11N5/c1-3-7-9-5(6)10-8-4-2/h3-4H,1-2H3,(H3,6,9,10)/b7-3-,8-4- |
| InChIKey | LIFUDFFVGVZGKR-VHOZIDCHSA-N |
| XLogP | -0.10 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|