About 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine
2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 59268463) has the molecular formula C11H14F3N3O
and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine |
| PubChem CID | 59268463 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | Nc1cc(C(F)(F)F)cc(N)c1OC1CCNC1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)6-3-8(15)10(9(16)4-6)18-7-1-2-17-5-7/h3-4,7,17H,1-2,5,15-16H2 |
| InChIKey | DWYWTTBNJPPITN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine?
The IUPAC name of 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine (CID 59268463) is 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine.
What is the SMILES notation for 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine?
The canonical SMILES for 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine is Nc1cc(C(F)(F)F)cc(N)c1OC1CCNC1.
What is the InChIKey of 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine?
The InChIKey is DWYWTTBNJPPITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3O/c12-11(13,14)6-3-8(15)10(9(16)4-6)18-7-1-2-17-5-7/h3-4,7,17H,1-2,5,15-16H2.
What are the key properties of 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine?
2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine has a molecular weight of 261.25 g/mol, XLogP of 1.61, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-3-yloxy-5-(trifluoromethyl)benzene-1,3-diamine is sourced from PubChem (CID 59268463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).