C33H37N7O3 — CID 59268706
1-[4-[2-[[2-[4-[3-(diethylamino)propoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-phenylurea (PubChem CID 59268706) has the molecular formula C33H37N7O3 and a molecular weight of 579.71 g/mol. Its IUPAC name is 1-[4-[2-[[2-[4-[3-(diethylamino)propoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-[[2-[4-[3-(diethylamino)propoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 59268706 |
| Molecular Formula | C33H37N7O3 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 1-[4-[2-[[2-[4-[3-(diethylamino)propoxy]phenyl]-[1,3]oxazolo[5,4-d]pyrimidin-7-yl]amino]ethyl]phenyl]-3-phenylurea |
| SMILES | CCN(CC)CCCOc1ccc(-c2nc3c(NCCc4ccc(NC(=O)Nc5ccccc5)cc4)ncnc3o2)cc1 |
| InChI | InChI=1S/C33H37N7O3/c1-3-40(4-2)21-8-22-42-28-17-13-25(14-18-28)31-39-29-30(35-23-36-32(29)43-31)34-20-19-24-11-15-27(16-12-24)38-33(41)37-26-9-6-5-7-10-26/h5-7,9-18,23H,3-4,8,19-22H2,1-2H3,(H,34,35,36)(H2,37,38,41) |
| InChIKey | WCISMWBRGKLJLF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|