C28H31N9O2S — CID 59268762
1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea (PubChem CID 59268762) has the molecular formula C28H31N9O2S and a molecular weight of 557.68 g/mol. Its IUPAC name is 1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea.
| Compound Name | 1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 59268762 |
| Molecular Formula | C28H31N9O2S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea |
| SMILES | CN(C)CCCOc1ccc(-c2nc3ncnc(NCCc4cnc(NC(=O)Nc5ccccc5)s4)c3[nH]2)cc1 |
| InChI | InChI=1S/C28H31N9O2S/c1-37(2)15-6-16-39-21-11-9-19(10-12-21)24-34-23-25(31-18-32-26(23)35-24)29-14-13-22-17-30-28(40-22)36-27(38)33-20-7-4-3-5-8-20/h3-5,7-12,17-18H,6,13-16H2,1-2H3,(H2,30,33,36,38)(H2,29,31,32,34,35) |
| InChIKey | RVADPNIHXMPKHT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 132.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|