C29H32N8O2S — CID 59268788
1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea (PubChem CID 59268788) has the molecular formula C29H32N8O2S and a molecular weight of 556.70 g/mol. Its IUPAC name is 1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea.
| Compound Name | 1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 59268788 |
| Molecular Formula | C29H32N8O2S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]ethyl]-1,3-thiazol-2-yl]-3-phenylurea |
| SMILES | CN(C)CCCOc1ccc(-c2nc3nccc(NCCc4cnc(NC(=O)Nc5ccccc5)s4)c3[nH]2)cc1 |
| InChI | InChI=1S/C29H32N8O2S/c1-37(2)17-6-18-39-22-11-9-20(10-12-22)26-34-25-24(14-16-31-27(25)35-26)30-15-13-23-19-32-29(40-23)36-28(38)33-21-7-4-3-5-8-21/h3-5,7-12,14,16,19H,6,13,15,17-18H2,1-2H3,(H2,30,31,34,35)(H2,32,33,36,38) |
| InChIKey | JIZSGXVRBHVSDB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|