C12H13N3O2 — CID 59268954
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-isocyanofuran-2-yl)methanone (PubChem CID 59268954) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-isocyanofuran-2-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-isocyanofuran-2-yl)methanone |
|---|---|
| PubChem CID | 59268954 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-isocyanofuran-2-yl)methanone |
| SMILES | [C-]#[N+]c1ccoc1C(=O)N1CC2CNCC2C1 |
| InChI | InChI=1S/C12H13N3O2/c1-13-10-2-3-17-11(10)12(16)15-6-8-4-14-5-9(8)7-15/h2-3,8-9,14H,4-7H2 |
| InChIKey | LXPOSQXURYECSW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|