C14H24O4 — CID 59269552
(1S,2S,6S,7S,9S)-7-ethyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 59269552) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (1S,2S,6S,7S,9S)-7-ethyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2S,6S,7S,9S)-7-ethyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 59269552 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (1S,2S,6S,7S,9S)-7-ethyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC[C@H]1C[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H24O4/c1-6-8-7-9-11(17-13(2,3)15-9)12-10(8)16-14(4,5)18-12/h8-12H,6-7H2,1-5H3/t8-,9-,10-,11-,12-/m0/s1 |
| InChIKey | NCYIFJGZMCHLSX-HTFCKZLJSA-N |
| XLogP | 2.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |