C18H34O6Si — CID 59269880
2-[(3aS,5R,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-ol (PubChem CID 59269880) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is 2-[(3aS,5R,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-ol.
| Compound Name | 2-[(3aS,5R,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-ol |
|---|---|
| PubChem CID | 59269880 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[(3aS,5R,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-ol |
| SMILES | C=CC(O)(CO[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]2OC(C)(C)OC2[C@H]1OC |
| InChI | InChI=1S/C18H34O6Si/c1-10-18(19,11-21-25(8,9)16(2,3)4)14-12(20-7)13-15(22-14)24-17(5,6)23-13/h10,12-15,19H,1,11H2,2-9H3/t12-,13?,14-,15+,18?/m1/s1 |
| InChIKey | QIVFSUYJMHYXFB-ILLDSPSKSA-N |
| XLogP | 2.82 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|