About 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide
3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide (PubChem CID 59269993) has the molecular formula C10H21NO3S
and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide |
| PubChem CID | 59269993 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCSCC(O)CO |
| InChI | InChI=1S/C10H21NO3S/c1-3-11(4-2)10(14)5-6-15-8-9(13)7-12/h9,12-13H,3-8H2,1-2H3 |
| InChIKey | GOPGVDKCCJGHOH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide?
The IUPAC name of 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide (CID 59269993) is 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide.
What is the SMILES notation for 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide?
The canonical SMILES for 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide is CCN(CC)C(=O)CCSCC(O)CO.
What is the InChIKey of 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide?
The InChIKey is GOPGVDKCCJGHOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3S/c1-3-11(4-2)10(14)5-6-15-8-9(13)7-12/h9,12-13H,3-8H2,1-2H3.
What are the key properties of 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide?
3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide has a molecular weight of 235.35 g/mol, XLogP of 0.33, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropylsulfanyl)-N,N-diethylpropanamide is sourced from PubChem (CID 59269993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).