C23H36O9 — CID 59270003
1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate (PubChem CID 59270003) has the molecular formula C23H36O9 and a molecular weight of 456.53 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59270003 |
| Molecular Formula | C23H36O9 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C1CCCCC1C(=O)OCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C23H36O9/c1-6-23(4,5)22(28)30-12-11-29-20(26)17-9-7-8-10-18(17)21(27)32-14-16(24)13-31-19(25)15(2)3/h16-18,24H,2,6-14H2,1,3-5H3 |
| InChIKey | SOKXBOMTWNNRFA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|