C26H40O11 — CID 59270030
1-O-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-3-oxopropyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate (PubChem CID 59270030) has the molecular formula C26H40O11 and a molecular weight of 528.60 g/mol. Its IUPAC name is 1-O-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-3-oxopropyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-3-oxopropyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59270030 |
| Molecular Formula | C26H40O11 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 1-O-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-3-oxopropyl] 2-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C1CCCCC1C(=O)OCCC(=O)OCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C26H40O11/c1-6-26(4,5)25(32)35-14-13-33-21(28)11-12-34-23(30)19-9-7-8-10-20(19)24(31)37-16-18(27)15-36-22(29)17(2)3/h18-20,27H,2,6-16H2,1,3-5H3 |
| InChIKey | HDSQHMXBHFWXGC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|