C24H30N2S4 — CID 59270672
2,5-bis(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 59270672) has the molecular formula C24H30N2S4 and a molecular weight of 474.79 g/mol. Its IUPAC name is 2,5-bis(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 59270672 |
| Molecular Formula | C24H30N2S4 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2,5-bis(4-hexylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | CCCCCCc1csc(-c2nc3sc(-c4cc(CCCCCC)cs4)nc3s2)c1 |
| InChI | InChI=1S/C24H30N2S4/c1-3-5-7-9-11-17-13-19(27-15-17)21-25-23-24(29-21)26-22(30-23)20-14-18(16-28-20)12-10-8-6-4-2/h13-16H,3-12H2,1-2H3 |
| InChIKey | XGRRWNICKUXVOP-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|