C16H6N2S4 — CID 59270675
2,5-bis(2-thiophen-2-ylethynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 59270675) has the molecular formula C16H6N2S4 and a molecular weight of 354.51 g/mol. Its IUPAC name is 2,5-bis(2-thiophen-2-ylethynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis(2-thiophen-2-ylethynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 59270675 |
| Molecular Formula | C16H6N2S4 |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 2,5-bis(2-thiophen-2-ylethynyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | C(#Cc1nc2sc(C#Cc3cccs3)nc2s1)c1cccs1 |
| InChI | InChI=1S/C16H6N2S4/c1-3-11(19-9-1)5-7-13-17-15-16(21-13)18-14(22-15)8-6-12-4-2-10-20-12/h1-4,9-10H |
| InChIKey | ZWEITVUGAOKWGB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|