About 2,3-diethyl-1,4-dimethylnaphthalene
2,3-diethyl-1,4-dimethylnaphthalene (PubChem CID 59270753) has the molecular formula C16H20
and a molecular weight of 212.34 g/mol. Its IUPAC name is 2,3-diethyl-1,4-dimethylnaphthalene.
Molecular Properties
| Compound Name | 2,3-diethyl-1,4-dimethylnaphthalene |
| PubChem CID | 59270753 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2,3-diethyl-1,4-dimethylnaphthalene |
| SMILES | CCc1c(CC)c(C)c2ccccc2c1C |
| InChI | InChI=1S/C16H20/c1-5-13-11(3)15-9-7-8-10-16(15)12(4)14(13)6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | SRXALZLKCRKDGY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-diethyl-1,4-dimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethyl-1,4-dimethylnaphthalene?
The IUPAC name of 2,3-diethyl-1,4-dimethylnaphthalene (CID 59270753) is 2,3-diethyl-1,4-dimethylnaphthalene.
What is the SMILES notation for 2,3-diethyl-1,4-dimethylnaphthalene?
The canonical SMILES for 2,3-diethyl-1,4-dimethylnaphthalene is CCc1c(CC)c(C)c2ccccc2c1C.
What is the InChIKey of 2,3-diethyl-1,4-dimethylnaphthalene?
The InChIKey is SRXALZLKCRKDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20/c1-5-13-11(3)15-9-7-8-10-16(15)12(4)14(13)6-2/h7-10H,5-6H2,1-4H3.
What are the key properties of 2,3-diethyl-1,4-dimethylnaphthalene?
2,3-diethyl-1,4-dimethylnaphthalene has a molecular weight of 212.34 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethyl-1,4-dimethylnaphthalene is sourced from PubChem (CID 59270753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).