C21H27N — CID 59270902
3,6-ditert-butyl-2,4,5,7-tetradeuterio-9-methylcarbazole (PubChem CID 59270902) has the molecular formula C21H27N and a molecular weight of 297.48 g/mol. Its IUPAC name is 3,6-ditert-butyl-2,4,5,7-tetradeuterio-9-methylcarbazole.
| Compound Name | 3,6-ditert-butyl-2,4,5,7-tetradeuterio-9-methylcarbazole |
|---|---|
| PubChem CID | 59270902 |
| Molecular Formula | C21H27N |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 3,6-ditert-butyl-2,4,5,7-tetradeuterio-9-methylcarbazole |
| SMILES | [2H]c1cc2c(c([2H])c1C(C)(C)C)c1c([2H])c(C(C)(C)C)c([2H])cc1n2C |
| InChI | InChI=1S/C21H27N/c1-20(2,3)14-8-10-18-16(12-14)17-13-15(21(4,5)6)9-11-19(17)22(18)7/h8-13H,1-7H3/i8D,9D,12D,13D |
| InChIKey | OJXMLNBTIJVABO-WBJPXBCQSA-N |
| XLogP | 5.93 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |