C10H13O8P — CID 59271028
(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl dihydrogen phosphate (PubChem CID 59271028) has the molecular formula C10H13O8P and a molecular weight of 292.18 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl dihydrogen phosphate.
| Compound Name | (4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59271028 |
| Molecular Formula | C10H13O8P |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl dihydrogen phosphate |
| SMILES | COC1=C(OC)C(=O)C(COP(=O)(O)O)=C(C)C1=O |
| InChI | InChI=1S/C10H13O8P/c1-5-6(4-18-19(13,14)15)8(12)10(17-3)9(16-2)7(5)11/h4H2,1-3H3,(H2,13,14,15) |
| InChIKey | GRHYXHJTZGNAFR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|