About 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione
2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione (PubChem CID 59271051) has the molecular formula C19H28O4
and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione.
Molecular Properties
| Compound Name | 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione |
| PubChem CID | 59271051 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione |
| SMILES | CC1CCC(=O)C(CC2CCC(=O)C(C)CCC2=O)CCC1=O |
| InChI | InChI=1S/C19H28O4/c1-12-3-7-18(22)14(5-9-16(12)20)11-15-6-10-17(21)13(2)4-8-19(15)23/h12-15H,3-11H2,1-2H3 |
| InChIKey | MLQBQUADSQSQHN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione?
The IUPAC name of 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione (CID 59271051) is 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione.
What is the SMILES notation for 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione?
The canonical SMILES for 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione is CC1CCC(=O)C(CC2CCC(=O)C(C)CCC2=O)CCC1=O.
What is the InChIKey of 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione?
The InChIKey is MLQBQUADSQSQHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O4/c1-12-3-7-18(22)14(5-9-16(12)20)11-15-6-10-17(21)13(2)4-8-19(15)23/h12-15H,3-11H2,1-2H3.
What are the key properties of 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione?
2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione has a molecular weight of 320.43 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[(5-methyl-2,6-dioxocyclooctyl)methyl]cyclooctane-1,5-dione is sourced from PubChem (CID 59271051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).