C33H58O2 — CID 59271269
(E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-9-en-6-ol (PubChem CID 59271269) has the molecular formula C33H58O2 and a molecular weight of 486.83 g/mol. Its IUPAC name is (E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-9-en-6-ol.
| Compound Name | (E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-9-en-6-ol |
|---|---|
| PubChem CID | 59271269 |
| Molecular Formula | C33H58O2 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.44 |
| IUPAC Name | (E)-13-(8a-hexyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-9-en-6-ol |
| SMILES | CCCCCCC12OC(C)(CCC/C(C)=C/CCC(C)(O)CCCCC)CCC1=CC=C(C)C2C |
| InChI | InChI=1S/C33H58O2/c1-8-10-12-14-25-33-29(5)28(4)19-20-30(33)21-26-32(7,35-33)24-16-18-27(3)17-15-23-31(6,34)22-13-11-9-2/h17,19-20,29,34H,8-16,18,21-26H2,1-7H3/b27-17+ |
| InChIKey | DBNSSJNFBHSAHY-WPWMEQJKSA-N |
| XLogP | 10.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|