C21H36O2 — CID 59271273
8a-ethyl-2,7,8-trimethyl-2-(4-methylhexyl)-4,6-dihydro-3H-chromen-6-ol (PubChem CID 59271273) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 8a-ethyl-2,7,8-trimethyl-2-(4-methylhexyl)-4,6-dihydro-3H-chromen-6-ol.
| Compound Name | 8a-ethyl-2,7,8-trimethyl-2-(4-methylhexyl)-4,6-dihydro-3H-chromen-6-ol |
|---|---|
| PubChem CID | 59271273 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 8a-ethyl-2,7,8-trimethyl-2-(4-methylhexyl)-4,6-dihydro-3H-chromen-6-ol |
| SMILES | CCC(C)CCCC1(C)CCC2=CC(O)C(C)=C(C)C2(CC)O1 |
| InChI | InChI=1S/C21H36O2/c1-7-15(3)10-9-12-20(6)13-11-18-14-19(22)16(4)17(5)21(18,8-2)23-20/h14-15,19,22H,7-13H2,1-6H3 |
| InChIKey | AEDOOVIQPBDCSS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|