C27H48O2 — CID 59271282
(E)-6,10-dimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-10-en-6-ol (PubChem CID 59271282) has the molecular formula C27H48O2 and a molecular weight of 404.68 g/mol. Its IUPAC name is (E)-6,10-dimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-10-en-6-ol.
| Compound Name | (E)-6,10-dimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-10-en-6-ol |
|---|---|
| PubChem CID | 59271282 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | (E)-6,10-dimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-10-en-6-ol |
| SMILES | CCCCCC(C)(O)CCC/C(C)=C/CCC1(C)CCC2=CCC(C)C(C)C2O1 |
| InChI | InChI=1S/C27H48O2/c1-7-8-9-17-26(5,28)18-10-12-21(2)13-11-19-27(6)20-16-24-15-14-22(3)23(4)25(24)29-27/h13,15,22-23,25,28H,7-12,14,16-20H2,1-6H3/b21-13+ |
| InChIKey | JBPHAGPFZLUKSL-FYJGNVAPSA-N |
| XLogP | 7.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|