C23H37O2- — CID 59271293
2-(4,8-dimethylnon-8-enyl)-2,7,8-trimethyl-3,4,6,8a-tetrahydrochromen-6-ol (PubChem CID 59271293) has the molecular formula C23H37O2- and a molecular weight of 345.55 g/mol. Its IUPAC name is 2-(4,8-dimethylnon-8-enyl)-2,7,8-trimethyl-3,4,6,8a-tetrahydrochromen-6-ol.
| Compound Name | 2-(4,8-dimethylnon-8-enyl)-2,7,8-trimethyl-3,4,6,8a-tetrahydrochromen-6-ol |
|---|---|
| PubChem CID | 59271293 |
| Molecular Formula | C23H37O2- |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | 2-(4,8-dimethylnon-8-enyl)-2,7,8-trimethyl-3,4,6,8a-tetrahydrochromen-6-ol |
| SMILES | C=C(C)[CH-]CCC(C)CCCC1(C)CCC2=CC(O)C(C)=C(C)C2O1 |
| InChI | InChI=1S/C23H37O2/c1-16(2)9-7-10-17(3)11-8-13-23(6)14-12-20-15-21(24)18(4)19(5)22(20)25-23/h9,15,17,21-22,24H,1,7-8,10-14H2,2-6H3/q-1 |
| InChIKey | TXDFNTBKXITUKH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|