C31H54O2 — CID 59271327
(E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-10-en-6-ol (PubChem CID 59271327) has the molecular formula C31H54O2 and a molecular weight of 458.77 g/mol. Its IUPAC name is (E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-10-en-6-ol.
| Compound Name | (E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-10-en-6-ol |
|---|---|
| PubChem CID | 59271327 |
| Molecular Formula | C31H54O2 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.41 |
| IUPAC Name | (E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-6,10-dimethyltridec-10-en-6-ol |
| SMILES | CCCCCC(C)(O)CCC/C(C)=C/CCC1(C)CCC2=CC=C(C)C(C)C2(CCCC)O1 |
| InChI | InChI=1S/C31H54O2/c1-8-10-12-20-29(6,32)21-13-15-25(3)16-14-22-30(7)24-19-28-18-17-26(4)27(5)31(28,33-30)23-11-9-2/h16-18,27,32H,8-15,19-24H2,1-7H3/b25-16+ |
| InChIKey | XCCMNMQCSPVTFV-PCLIKHOPSA-N |
| XLogP | 9.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|