C35H58O — CID 59271339
2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-8a-octyl-3,4-dihydrochromene (PubChem CID 59271339) has the molecular formula C35H58O and a molecular weight of 494.85 g/mol. Its IUPAC name is 2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-8a-octyl-3,4-dihydrochromene.
| Compound Name | 2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-8a-octyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 59271339 |
| Molecular Formula | C35H58O |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.45 |
| IUPAC Name | 2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-8a-octyl-3,4-dihydrochromene |
| SMILES | CCCC/C=C(\C)CCC/C(C)=C/CCC1(C)CCC2=C=CC(C)=C(C)C2(CCCCCCCC)O1 |
| InChI | InChI=1S/C35H58O/c1-8-10-12-13-14-16-27-35-32(6)31(5)23-24-33(35)25-28-34(7,36-35)26-18-22-30(4)21-17-20-29(3)19-15-11-9-2/h19,22-23H,8-18,20-21,25-28H2,1-7H3/b29-19+,30-22+ |
| InChIKey | PYGLQPWPQQKHSU-KUFPGBLPSA-N |
| XLogP | 11.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|