C28H48O3 — CID 59271352
(E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-5-enoic acid (PubChem CID 59271352) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-5-enoic acid.
| Compound Name | (E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-5-enoic acid |
|---|---|
| PubChem CID | 59271352 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-5-enoic acid |
| SMILES | C/C(=C\CCC(C)C(=O)O)CCCC(C)CCCC1(C)CCC2C=CC(C)C(C)C2O1 |
| InChI | InChI=1S/C28H48O3/c1-20(12-8-14-23(4)27(29)30)10-7-11-21(2)13-9-18-28(6)19-17-25-16-15-22(3)24(5)26(25)31-28/h12,15-16,21-26H,7-11,13-14,17-19H2,1-6H3,(H,29,30)/b20-12+ |
| InChIKey | ZYBCRWHQVFQEHG-UDWIEESQSA-N |
| XLogP | 7.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|