C28H46O2 — CID 59271371
(5E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)trideca-1,5-dien-1-one (PubChem CID 59271371) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is (5E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)trideca-1,5-dien-1-one.
| Compound Name | (5E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)trideca-1,5-dien-1-one |
|---|---|
| PubChem CID | 59271371 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | (5E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)trideca-1,5-dien-1-one |
| SMILES | CC(=C=O)CC/C=C(\C)CCCC(C)CCCC1(C)CCC2=CCC(C)C(C)C2O1 |
| InChI | InChI=1S/C28H46O2/c1-21(12-8-13-23(3)20-29)10-7-11-22(2)14-9-18-28(6)19-17-26-16-15-24(4)25(5)27(26)30-28/h12,16,22,24-25,27H,7-11,13-15,17-19H2,1-6H3/b21-12+ |
| InChIKey | HHZHYGBOGGQQDD-CIAFOILYSA-N |
| XLogP | 8.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|