About 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene
5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene (PubChem CID 59271402) has the molecular formula C17H30O
and a molecular weight of 250.43 g/mol. Its IUPAC name is 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene |
| PubChem CID | 59271402 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene |
| SMILES | CCCCCCOC1C(CCC)=CC=C(C)C1C |
| InChI | InChI=1S/C17H30O/c1-5-7-8-9-13-18-17-15(4)14(3)11-12-16(17)10-6-2/h11-12,15,17H,5-10,13H2,1-4H3 |
| InChIKey | IYKDGSSGZGCJNF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene?
The IUPAC name of 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene (CID 59271402) is 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene.
What is the SMILES notation for 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene?
The canonical SMILES for 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene is CCCCCCOC1C(CCC)=CC=C(C)C1C.
What is the InChIKey of 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene?
The InChIKey is IYKDGSSGZGCJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O/c1-5-7-8-9-13-18-17-15(4)14(3)11-12-16(17)10-6-2/h11-12,15,17H,5-10,13H2,1-4H3.
What are the key properties of 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene?
5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene has a molecular weight of 250.43 g/mol, XLogP of 5.27, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexoxy-1,6-dimethyl-4-propylcyclohexa-1,3-diene is sourced from PubChem (CID 59271402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).