About 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate
4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate (PubChem CID 59271432) has the molecular formula C18H31O2-
and a molecular weight of 279.44 g/mol. Its IUPAC name is 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate.
Molecular Properties
| Compound Name | 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate |
| PubChem CID | 59271432 |
| Molecular Formula | C18H31O2- |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate |
| SMILES | C=CC(C)CCC1=CC([O-])C(C)C(C)C1OCCCC |
| InChI | InChI=1S/C18H31O2/c1-6-8-11-20-18-15(5)14(4)17(19)12-16(18)10-9-13(3)7-2/h7,12-15,17-18H,2,6,8-11H2,1,3-5H3/q-1 |
| InChIKey | TYQPPUDSUQCMKL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate?
The IUPAC name of 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate (CID 59271432) is 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate.
What is the SMILES notation for 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate?
The canonical SMILES for 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate is C=CC(C)CCC1=CC([O-])C(C)C(C)C1OCCCC.
What is the InChIKey of 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate?
The InChIKey is TYQPPUDSUQCMKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31O2/c1-6-8-11-20-18-15(5)14(4)17(19)12-16(18)10-9-13(3)7-2/h7,12-15,17-18H,2,6,8-11H2,1,3-5H3/q-1.
What are the key properties of 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate?
4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate has a molecular weight of 279.44 g/mol, XLogP of 3.72, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-5,6-dimethyl-3-(3-methylpent-4-enyl)cyclohex-2-en-1-olate is sourced from PubChem (CID 59271432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).