C12H18O — CID 59271485
2,7,8-trimethyl-3,4,8,8a-tetrahydro-2H-chromene (PubChem CID 59271485) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 2,7,8-trimethyl-3,4,8,8a-tetrahydro-2H-chromene.
| Compound Name | 2,7,8-trimethyl-3,4,8,8a-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 59271485 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2,7,8-trimethyl-3,4,8,8a-tetrahydro-2H-chromene |
| SMILES | CC1=CC=C2CCC(C)OC2C1C |
| InChI | InChI=1S/C12H18O/c1-8-4-6-11-7-5-9(2)13-12(11)10(8)3/h4,6,9-10,12H,5,7H2,1-3H3 |
| InChIKey | BXITWLZFSFBKCH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |