C32H50O2 — CID 59271499
(5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-1,5,10-trien-1-one (PubChem CID 59271499) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is (5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-1,5,10-trien-1-one.
| Compound Name | (5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-1,5,10-trien-1-one |
|---|---|
| PubChem CID | 59271499 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | (5E,10E)-13-(8a-butyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-1,5,10-trien-1-one |
| SMILES | CCCCC12OC(C)(CC/C=C(\C)CCC/C(C)=C/CCC(C)=C=O)CCC1=CC=C(C)C2C |
| InChI | InChI=1S/C32H50O2/c1-8-9-22-32-29(6)28(5)18-19-30(32)20-23-31(7,34-32)21-12-17-26(3)14-10-13-25(2)15-11-16-27(4)24-33/h15,17-19,29H,8-14,16,20-23H2,1-7H3/b25-15+,26-17+ |
| InChIKey | CIJBQCGMRWLCEJ-VUFZMPSASA-N |
| XLogP | 9.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|