C33H62O3 — CID 59271513
4-hexoxy-3-[(E)-11-hydroxy-3,7,11-trimethylhexadec-7-enyl]-5,6-dimethylcyclohex-2-en-1-ol (PubChem CID 59271513) has the molecular formula C33H62O3 and a molecular weight of 506.86 g/mol. Its IUPAC name is 4-hexoxy-3-[(E)-11-hydroxy-3,7,11-trimethylhexadec-7-enyl]-5,6-dimethylcyclohex-2-en-1-ol.
| Compound Name | 4-hexoxy-3-[(E)-11-hydroxy-3,7,11-trimethylhexadec-7-enyl]-5,6-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 59271513 |
| Molecular Formula | C33H62O3 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.47 |
| IUPAC Name | 4-hexoxy-3-[(E)-11-hydroxy-3,7,11-trimethylhexadec-7-enyl]-5,6-dimethylcyclohex-2-en-1-ol |
| SMILES | CCCCCCOC1C(CCC(C)CCC/C(C)=C/CCC(C)(O)CCCCC)=CC(O)C(C)C1C |
| InChI | InChI=1S/C33H62O3/c1-8-10-12-14-24-36-32-29(6)28(5)31(34)25-30(32)21-20-27(4)18-15-17-26(3)19-16-23-33(7,35)22-13-11-9-2/h19,25,27-29,31-32,34-35H,8-18,20-24H2,1-7H3/b26-19+ |
| InChIKey | HCYAWSXHXZUOFL-LGUFXXKBSA-N |
| XLogP | 9.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|