C29H54O2 — CID 59271515
16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecan-6-ol (PubChem CID 59271515) has the molecular formula C29H54O2 and a molecular weight of 434.75 g/mol. Its IUPAC name is 16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecan-6-ol.
| Compound Name | 16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecan-6-ol |
|---|---|
| PubChem CID | 59271515 |
| Molecular Formula | C29H54O2 |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 434.41 |
| IUPAC Name | 16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecan-6-ol |
| SMILES | CCCCCC(C)(O)CCCC(C)CCCC(C)CCC1=CCC(C)C(C)=C1OCC |
| InChI | InChI=1S/C29H54O2/c1-8-10-11-21-29(7,30)22-13-16-23(3)14-12-15-24(4)17-19-27-20-18-25(5)26(6)28(27)31-9-2/h20,23-25,30H,8-19,21-22H2,1-7H3 |
| InChIKey | XAQXPKXBRINMDB-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|