About 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate
4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate (PubChem CID 59271520) has the molecular formula C14H23O2-
and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate.
Molecular Properties
| Compound Name | 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate |
| PubChem CID | 59271520 |
| Molecular Formula | C14H23O2- |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate |
| SMILES | CCCCOC1=C(C)C(C)C([O-])C=C1CC |
| InChI | InChI=1S/C14H23O2/c1-5-7-8-16-14-11(4)10(3)13(15)9-12(14)6-2/h9-10,13H,5-8H2,1-4H3/q-1 |
| InChIKey | OJSNGZXHQVQCGD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate?
The IUPAC name of 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate (CID 59271520) is 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate.
What is the SMILES notation for 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate?
The canonical SMILES for 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate is CCCCOC1=C(C)C(C)C([O-])C=C1CC.
What is the InChIKey of 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate?
The InChIKey is OJSNGZXHQVQCGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23O2/c1-5-7-8-16-14-11(4)10(3)13(15)9-12(14)6-2/h9-10,13H,5-8H2,1-4H3/q-1.
What are the key properties of 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate?
4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate has a molecular weight of 223.34 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-3-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-olate is sourced from PubChem (CID 59271520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).