C12H16N2O2 — CID 59271800
6-ethenyl-2,3-dimethyl-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one (PubChem CID 59271800) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-ethenyl-2,3-dimethyl-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one.
| Compound Name | 6-ethenyl-2,3-dimethyl-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 59271800 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 6-ethenyl-2,3-dimethyl-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one |
| SMILES | C=CC1COCCc2nc(C)c(C)c(=O)n21 |
| InChI | InChI=1S/C12H16N2O2/c1-4-10-7-16-6-5-11-13-9(3)8(2)12(15)14(10)11/h4,10H,1,5-7H2,2-3H3 |
| InChIKey | IJCVMBIAZHQCFB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|