About 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde
7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde (PubChem CID 59271931) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde.
Molecular Properties
| Compound Name | 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde |
| PubChem CID | 59271931 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde |
| SMILES | O=Cc1cc2c(nn1)CCOC2 |
| InChI | InChI=1S/C8H8N2O2/c11-4-7-3-6-5-12-2-1-8(6)10-9-7/h3-4H,1-2,5H2 |
| InChIKey | WEJRGMIXOFDNPL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde?
The IUPAC name of 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde (CID 59271931) is 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde.
What is the SMILES notation for 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde?
The canonical SMILES for 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde is O=Cc1cc2c(nn1)CCOC2.
What is the InChIKey of 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde?
The InChIKey is WEJRGMIXOFDNPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-4-7-3-6-5-12-2-1-8(6)10-9-7/h3-4H,1-2,5H2.
What are the key properties of 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde?
7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde has a molecular weight of 164.16 g/mol, XLogP of 0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carbaldehyde is sourced from PubChem (CID 59271931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).