About 3-methyl-5,6,7,8-tetrahydrocinnoline
3-methyl-5,6,7,8-tetrahydrocinnoline (PubChem CID 59271933) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-methyl-5,6,7,8-tetrahydrocinnoline.
Molecular Properties
| Compound Name | 3-methyl-5,6,7,8-tetrahydrocinnoline |
| PubChem CID | 59271933 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-methyl-5,6,7,8-tetrahydrocinnoline |
| SMILES | Cc1cc2c(nn1)CCCC2 |
| InChI | InChI=1S/C9H12N2/c1-7-6-8-4-2-3-5-9(8)11-10-7/h6H,2-5H2,1H3 |
| InChIKey | LSCOWSXPDOUVCG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5,6,7,8-tetrahydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6,7,8-tetrahydrocinnoline?
The IUPAC name of 3-methyl-5,6,7,8-tetrahydrocinnoline (CID 59271933) is 3-methyl-5,6,7,8-tetrahydrocinnoline.
What is the SMILES notation for 3-methyl-5,6,7,8-tetrahydrocinnoline?
The canonical SMILES for 3-methyl-5,6,7,8-tetrahydrocinnoline is Cc1cc2c(nn1)CCCC2.
What is the InChIKey of 3-methyl-5,6,7,8-tetrahydrocinnoline?
The InChIKey is LSCOWSXPDOUVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-6-8-4-2-3-5-9(8)11-10-7/h6H,2-5H2,1H3.
What are the key properties of 3-methyl-5,6,7,8-tetrahydrocinnoline?
3-methyl-5,6,7,8-tetrahydrocinnoline has a molecular weight of 148.21 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6,7,8-tetrahydrocinnoline is sourced from PubChem (CID 59271933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).