C24H20F2N4O3 — CID 59272523
N-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide (PubChem CID 59272523) has the molecular formula C24H20F2N4O3 and a molecular weight of 450.45 g/mol. Its IUPAC name is N-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | N-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59272523 |
| Molecular Formula | C24H20F2N4O3 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
| SMILES | [H]/N=C/c1cc(-c2nc(NC(=O)C3(c4ccc5c(c4)OC(F)(F)O5)CC3)ccc2C)ccc1N |
| InChI | InChI=1S/C24H20F2N4O3/c1-13-2-7-20(29-21(13)14-3-5-17(28)15(10-14)12-27)30-22(31)23(8-9-23)16-4-6-18-19(11-16)33-24(25,26)32-18/h2-7,10-12,27H,8-9,28H2,1H3,(H,29,30,31)/b27-12+ |
| InChIKey | CRCJTZIOAGIOEV-KKMKTNMSSA-N |
| XLogP | 4.63 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|